PubMed Health⌕ Search

Biomedical subjects

T Hughbanks

Publications and source records attributed to T Hughbanks.

6 recordsLinked to original sources
PubMed2001

Excision of zirconium iodide clusters from highly cross-linked solids.

Highly cross-linked cluster precursors KZr6I14B, Zr6I12B, KZr6I14C, and Zr6I12C were, successfully excised in deoxygenated water, and the resulting red aqueous solutions of clusters exhibit better kinetic stability with respect to decomposition than their chloride and bromide analogues. On traversing the Cl-->I series, NMR measurements show increasing deshielding of the interstitial atoms (Z = B, C) in Zr6ZX12 clusters and cyclic voltammetry reveals increasingly positive reduction potentials for the [(Zr6BX12)(H2O)6]+ ions. Several new cluster complexes have been crystallized from aqueous or methanolic solutions. Crystallographic data for these compounds are as follows: [(Zr6BI12)(H2O)6]Ix11.7(H2O) (1), triclinic, P1, a = 10.2858(7) A, b = 11.3045(8) A, c = 20.808(1) A, alpha = 77.592(1) degrees, beta = 79.084(1) degrees, gamma = 77.684(1) degrees, Z = 2; [(Zr6BI12)]+[I(CH3OH)6]- (2), hexagonal, R3, a = 17.706(1) A, c = 13.910(1) A, Z = 3, [(Zr6CI12)(H2O)6]I(2).4(H2O) (3), triclinic, P1, a = 10.1566(5) A, b = 10.4513(5) A, c = 10.7549(6) A, alpha = 117.552(1) degrees, beta = 96.443(1) degrees, gamma = 96.617(1) degrees, Z = 1.

Journal Article↗
PubMed2000

Synthesis and structures of new ternary aluminum chalcogenides: LiAlSe2, alpha-LiAlTe2, and beta-LiAlTe2.

The synthesis and crystal structures of new ternary aluminum chalcogenides, LiAlSe2, alpha-LiAlTe2, and beta-LiAlTe2, are reported. These compounds are synthesized by solid-state reaction at 800 degrees C. The single-crystal X-ray structures of these compounds have been determined. LiAlSe2: a = 68228(9) A, b = 8266(1) A, c = 65236(7) A, Pna2(1) (No 33, Z = 4) alpha-LiAlTe2: a = 65317(4) A, c = 116904(9) A, I42d (No 122, Z = 4) beta-LiAlTe2: a = 44810(6) A, c = 7096(1) A, P3m1 (No 156, Z = 1). These ternary compounds are formed by fusion of AlQ4 (Q = Se, Te) tetrahedra. LiAlSe2 shows beta-NaFeO2 structure type, which can be viewed as a wurtzite superstructure. alpha-LiAlTe2 adopts chalcopyrite structure type. In LiAlSe2 and alpha-LiAlTe2, AlQ4 (Q = Se, Te) tetrahedra share four corners to build three-dimensional structures and Li atoms are located in the tetrahedral sites between the chalcogen layers. beta-LiAlTe2 has polar layers formed by three-corner shared AlTe4 tetrahedra, and Li cations are in the distorted antiprisms between the layers. 7Li MAS NMR studies show that chemical shifts of Li in these ternary chalcogenides are nearly identical regardless of different chemical environments.

Journal Article↗
PubMed2000

Chloroaluminate ionic liquids as reagents for isolating soluble hexanuclear zirconium halide cluster compounds.

Ambient-temperature chloroaluminate molten salts, mixtures of aluminum trichloride (AlCl3) and 1-ethyl-3-methylimidazolium chloride (ImCl), have been used as solvents to excise and isolate centered hexanuclear zirconium halide clusters from their solid-state precursors. Cluster compounds synthesized via high-temperature reactions, KZr6CCl15 and Li2Zr6MnCl15, were dissolved into basic molten salts at 100-110 degrees C. The C-centered cluster compound, Im4Zr6CCl18, was isolated in 70% yield, and the Mn-centered cluster compound, Im5Zr6MnCl18.C7H(8).2CH3CN, was isolated in 54% yield. Im5Zr6BCl18 is efficiently oxidized by ferrocenium tetrafluoroborate, and one-electron-oxidized B-centered cluster, [(Zr6B)Cl18]4-, was isolated in 90% yield as the salt Im4Zr6BCl18.

Journal Article↗
PubMed2000

Reduced zirconium halide clusters in aqueous solution.

Reduced hexazirconium halide cluster compounds have good solubility and stability in strongly acidic and/or halide-rich aqueous solutions. Cyclic voltammetric (CV) measurements in aqueous media established that [(Zr6BCl12)(H2O)6]2+/+ and [(Zr6BBr12)(H2O)6]2+/+ exhibited positive half-wave potentials (E1/2 = 0.059V and 0.160 V, respectively) vs the SHE, indicating that these clusters are only modestly reducing. Several new crystalline cluster compounds have been isolated from cold 12 M HCl solutions; the structures of each contain extended hydrogen-bonding water networks. Crystallographic data for these compounds are reported as follows: [Rb0.44(H3O)4.56][(Zr6BCl12)Cl6].19.44H2O (3), cubic, Im3m, a = 13.8962(3) A, Z = 2; (H3O)5[(Zr6BeCl12)Cl6].19H2O (4), cubic, Im3m, a = 13.8956(4) A, Z = 2; (H3O)5[(Zr6MnCl12)Cl6].19H2O (5), cubic, Im3m, a = 14.029(3) A, Z = 2; (H3O)4[(Zr6BCl12)Cl6].12.97H2O (6), tetragonal, P4(2)/mnm, a = 11.5373(2) A, c = 15.7169(4) A, Z = 2; (H3O)4[(Zr6BCl2)Br6].13.13H2O (7), tetragonal, P4(2)/mnm, a = 11.7288(6) A, c = 15.931(1) A, Z = 2.

Journal Article↗