PubMed Health⌕ Search

Biomedical subjects

Yangguang Li

Publications and source records attributed to Yangguang Li.

13 recordsLinked to original sources
PubMed2006

Synthesis, characterization, and crystal structures of two novel high-nuclear nickel-substituted dimeric polyoxometalates.

Two novel high-nuclear Ni-substituted polyoxometalates Na9K[Ni7(OH)4(H2O)(CO3)2(HCO3)(A-alpha-SiW9O34)(beta-SiW10O37)].5H3O.18H2O (1) and K6Na4[{Ni6(H2O)4(mu2-H2O)4(mu3-OH)2}(x-SiW9O34)2].17.5H2O (2) have been obtained by reaction of K(8)[gamma-SiW10O36] with NiCl2.2H2O in basic conditions. Compounds 1 and 2 all represent the first polyoxometalates substituted by seven and six Ni centers, respectively. Also, compound 1 exhibits a novel asymmetric dimeric structure, composed of [A-alpha-SiW9O34]10- and [beta-SiW10O37]10- units linked by a Ni7 cluster and three carbonates, which exhibit tri- and bidentate coordination modes in 1.

Journal Article↗
PubMed2006

New valence-sandwich [Mn(II)4Mn(III)4Mn(II)4] aggregate showing single-molecule magnet behavior.

The reaction of manganese(II) acetate, 1,1,1-tris(hydroxymethyl)methane (H3thme), and triethylamine in methanol leads to the formation of [Mn12O2(OMe)2(thme)4(OAc)10(H2O)4].2MeOH. The [Mn(III)4Mn(II)8] core consists of a central [Mn(III)4O6] rhombus sandwiched by two [Mn(II)4O7] fragments. Frequency-dependent ac susceptibility and hysteresis loops in the magnetization indicate single-molecule magnet behavior with a pure quantum-tunneling regime of relaxation below 0.2 K.

Journal Article↗
PubMed2006

New polyoxometalate compounds built up of lacunary Wells-Dawson anions and trivalent lanthanide cations.

Five new polyoxometalate compounds built on lacunary Wells-Dawson anions and trivalent lanthanide cations, KNa3[Nd2(H2O)10(alpha2-P2W17O61)].11H2O (1), (H3O)[Nd3(H2O)17(alpha2-P2W17O61)].6.75H2O (2), (H2bpy)2[Nd2(H2O)9 (alpha2-P2W17O61)].4.5H2O (3), (H2bpy)2[La2(H2O)9(alpha2-P2W17O61)].4.5H2O (4), and (H2bpy)2[Eu2(H2O)9(alpha2-P2W17O61)].5H2O (5), have been synthesized and characterized by elemental analysis, IR, TG, and single-crystal X-ray diffraction. Compound 1 shows a bisupporting polyoxometalate cluster structure where two {Nd(H2O)7}3+ fragments are supported on the polyoxometalate dimer [{Nd(H2O)3(alpha2-P2W17O61)}2]14-; this represents the first bisupporting polyoxometalate compound based on a polyoxometalate dimer. Compound 2 displays a 1D chain structure built up of bisupporting polyoxoanions [{Nd(H2O)7}2{Nd(H2O)3(alpha2-P2W17O61)}2]8- and Nd3+ ions. Compounds 3-5 are isostructural and show a 2D structure constructed of 1D polyoxometalate chains of [Ln(H2O)2(alpha2-P2W17O61)]n(7n-) linked by Ln3+ ions. Compounds 2-5 represent the first extended structures formed by lacunary Wells-Dawson anions and trivalent lanthanide ions. The influence of the Ln3+/[alpha2-P2W17O61]10- ratio on the syntheses of these five compounds has been studied. Furthermore, the fluorescent activity of compound 5 is reported.

Journal Article↗
PubMed2005

Self-assembly of a series of extended architectures based on polyoxometalate clusters and silver coordination complexes.

Three unusual compounds based on polyoxometalate building blocks, [(H2O)5Na2(C6NO2H4)(C6NO2H5)3Ag2][Ag2IMo6O24(H2O)4] x 6.25H2O (1), [(H2O)4Na2(C6NO2H5)6Ag3][IMo6O24] x 6H2O (2), and (C6NO2H6)2[(C6NO2H5)2Ag][Cr(OH)6Mo6O18] x 4H2O (3), have been synthesized and characterized by elemental analysis; IR, XPS, and ESR spectroscopy; TG analysis; and single-crystal X-ray diffraction. Compound 1 is constructed from the cationic two-dimensional (2D) coordination polymer sheets which are constituted of [(H2O)5Na2(C6NO2H4)(C6NO2H5)3Ag2]3+ and anionic [Ag2IMo6O24(H2O)4]3- chains as pillars, forming a three-dimensional (3D) supramolecular framework via weak Ag-O interactions. Compound 2 is composed of the well-defined [IMo6O24]5- building blocks, which are linked through trinuclear Ag-pyridine-3-carboxylic acid, [(C6NO2H5)6Ag3]3+, fragments into a one-dimensional (1D) hybrid chain; adjacent chains are further connected by sodium cations to yield a novel 2D network. Compound 3 has a 1D chainlike structure constructed from [Cr(OH)6Mo6O18]3- building blocks and Ag-pyridine-4-carboxylic acid coordination units. The crystal data for these compounds are the following: 1, triclinic, P1, a = 13.280(3) A, b = 13.641(3) A, c = 16.356(3) A, alpha = 89.68(3) degrees, beta = 88.31(3) degrees, gamma = 75.87(3) degrees, Z = 2; 2, triclinic, P1, a = 11.978(2) A, b = 12.008(2) A, c = 13.607(3) A, alpha = 116.14(3) degrees, beta = 108.85(3) degrees, gamma = 93.86(3) degrees, Z = 1; 3, triclinic, P1, a = 10.458(2) A, b = 10.644(2) A, c = 12.295(3) A, alpha = 97.40(3) degrees, beta = 112.38(3) degrees, gamma = 113.59(3) degrees, Z = 1.

Journal Article↗
PubMed2004

Syntheses, structures, and photoluminescence of a novel class of d10 metal complexes constructed from pyridine-3,4-dicarboxylic acid with different coordination architectures.

Two novel d(10) metal coordination polymers [Zn(PDB)](n)() (1) and [Cd(3)(PDB)(2)(OH)(2)(H(2)O)(2)](n)() (2) (H(2)PDB = pyridine-3,4-dicarboxylic acid) have been synthesized under hydrothermal conditions and characterized by elemental analysis, IR, TG analysis, and single-crystal X-ray diffraction. Crystal data for 1: C(7)H(3)NO(4)Zn, orthorhombic Pna2(1), a = 8.423(17) A, b = 6.574(13) A, c = 12.899(3) A, Z = 4. Crystal data for 2: C(14)H(12)N(2)O(12)Cd(3), monoclinic C2/c, a= 20.130(4) A, b = 6.692(13) A, c = 13.081(3) A, beta = 102.78(3) degrees, Z = 4. Both compounds exhibit novel three-dimensional frameworks. Compound 1 not only possesses a one-dimensional rectangular channel but also contains infinite double-stranded helical chains. Compound 2 has two different types of channels, one being built up from pyridine rings and [CdO(5)N] and [CdO(6)] building units and the other being constructed from pyridine rings and [CdO(5)N] building units. Furthermore, both compounds show strong photoluminescence properties at room temperature.

Journal Article↗
PubMed2003

Two novel vanadium tellurites covalently bonded with metal-organic complex moieties: M(phen)V(2)TeO(8) (M = Cu, Ni).

Two novel two-dimensional organic-inorganic hybrid vanadium tellurites M(phen)V(2)TeO(8) (M = Cu (1), Ni (2)) have been hydrothermally synthesized and characterized by the elemental analyses, IR spectra, EPR spectrum, XPS spectra, TG analyses, and single-crystal X-ray diffraction. Compound 1 crystallizes in the monoclinic system, space group P2(1)/c, with a = 9.2193(18) A, b = 7.9853(16) A, c = 21.401(4) A, beta = 97.54(3) degrees, and Z = 4. Compound 2 crystallizes in the monoclinic system, space group P2(1)/c, with a = 9.2163(18) A, b = 7.9897(16) A, c = 21.386(4) A, beta = 97.52(3) degrees, and Z = 4. Compounds 1 and 2 are isostructural, and both exhibit interesting two-dimensional networks with [V(2)TeO(8)]( infinity ) double-chain-like ribbons bridged by metal-organic complex moieties [M(phen)](2+) (M = Cu and Ni). Furthermore, the three-dimensional supramolecular architectures of compounds 1 and 2 are formed by pi-pi stacking interactions of phen groups between adjacent layers.

Journal Article↗
PubMed2003

A novel three-dimensional network constructed from tetramolybdate clusters linked via two types of copper complex fragments: synthesis, characterization, and magnetic behavior of [[CuII(2,2'-bpy)][CuII(IN)2][Mo4O12(OH)2]].

A novel three-dimensional copper molybdate with mixed ligands, [[Cu(II)(2,2'-bpy)][Cu(II)(IN)(2)][Mo(4)O(12)(OH)(2)]] (IN(-) = isonicotinate ion, 2,2'-bpy = 2,2'-bipyridine), 1, has been hydrothermally synthesized and structurally characterized, and this compound is built from an unprecedented tetranuclear molybdenum oxide cluster covalently bonded to two types of copper complex fragments, [Cu(II)(2,2'-bpy)](2+) and [Cu(II)(IN)(2)], via terminal oxygen atoms of [MoO(6)] octahedra. Crystal data for compound 1: monoclinic, space group C2/c, a = 16.4755 A, b = 10.3714 A, c = 17.4382 A, alpha = 90.0000 degrees, beta = 94.8098 degrees, gamma = 90.0000 degrees; V = 2969.24 A(3); Z = 2. Variable temperature magnetic susceptibility indicates that both ferromagnetic and antiferromagnetic interactions exist in 1.

Journal Article↗
PubMed2003

Novel polyoxometalate-templated, 3-D supramolecular networks based on lanthanide dimers: synthesis, structure, and fluorescent properties of [Ln2(DNBA)4(DMF)8][Mo6O19] (DNBA = 3,5-dinitrobenzoate).

The spherical Lindquist type polyoxometalate, Mo(6)O(19)(2)(-), has been used as a noncoordinating anionic template for the construction of novel three-dimensional lanthanide-aromatic monocarboxylate dimer supramolecular networks [Ln(2)(DNBA)(4)(DMF)(8)][Mo(6)O(19)] (Ln = La 1, Ce 2, and Eu 3, DNBA = 3,5-dinitrobenzoate, DMF = dimethylformamide). The title compounds are characterized by elemental analyses, IR, and single-crystal X-ray diffractions. X-ray diffraction experiments reveal that two Ln(III) ions are bridged by four 3,5-dinitrobenzoate anions as asymmetrically bridging ligands, leading to dimeric cores, [Ln(2)(DNBA)(4)(DMF)(8)](2+); [Ln(2)(DNBA)(4)(DMF)(8)](2+) groups are joined together by pi-pi stacking interactions between the aromatic groups to form a two-dimensional grid-like network; the 2-D supramolecular layers are further extended into 3-D supramolecular networks with 1-D box-like channels by hydrogen-bonding interactions, in which hexamolybdate polyanions reside. The compounds represent the first examples of 3-D carboxylate-bridged lanthanide dimer supramolecular "host" networks formed by pi-pi stacking and hydrogen-bonding interactions encapsulating noncoordinating "guest" polyoxoanion species. The fluorescent activity of compound 3 is reported.

Journal Article↗
PubMed2003

Modified polyoxometalates: Hydrothermal syntheses and crystal structures of three novel reduced and capped Keggin derivatives decorated by transition metal complexes.

Three novel polyoxometalate derivatives decorated by transition metal complexes have been hydrothermally synthesized. Compound 1 consists of [PMo(VI)(6)Mo(V)(2)V(IV)(8)O(44)[Co (2,2'-bipy)(2)(H(2)O)](4)](3+) polyoxocations and [PMo(VI)(4-)Mo(V)(4)V(IV)(8)O(44)[Co(2,2'-bipy)(2)(H(2)O)](2)](3-) polyoxoanions, which are both built on mixed-metal tetracapped [PMo(8)V(8)O(44)] subunits covalently bonded to four or two [Co(2,2'-bpy)(2)(H(2)O)](2+) clusters via terminal oxo groups of the capping V atoms. Compound 2 is built on [PMo(VI)(8)V(IV)(6)O(42)[Cu(I)(phen)](2)](5-) clusters constructed from mixed-metal bicapped [PMo(VI)(8)V(IV)(6)O(42)](7-) subunits covalently bonded to two [Cu(phen)](+) fragments in the similar way to 1. The structure of 3 is composed of [PMo(VI)(9)Mo(V)(3)O(40)](6-) units capped by two divalent Ni atoms via four bridging oxo groups. The crystal data for these are the following: C(120)H(126)Co(6)Mo(16)N(24)O(103)P(2)V(16) (1), triclinic P1, a = 15.6727(2) A, b = 17.3155(3) A, c = 19.5445(2) A, alpha = 86.1520(1) degrees, beta = 81.2010(1) degrees, gamma = 63.5970(1) degrees, Z = 1; C(120)H(85)Cu(6-)Mo(8)N(20)O(44)PV(6) (2), triclinic P1, a = 14.565(4) A, b = 15.899(3) A, c = 16.246(4) A, alpha = 116.289(2) degrees, beta = 103.084(2) degrees, gamma = 94.796(2) degrees, Z = 1; C(60)H(40)Mo(12)N(10)Ni(3)O(40)P (3), monoclinic P2(1)/c, a = 14.804(3) A, b = 22.137(4) A, c = 25.162(5) A, alpha = 90 degrees, beta = 98.59(3) degrees, gamma = 90 degrees, Z = 4.

Journal Article↗
PubMed2003

New two-dimensional metal-organic networks constructed from 1,2,4,5-benzenetetracarboxylate and chelate ligands.

Two novel nickel coordination polymers [Ni(2)(2,2'-bipy)(2)(OH)(2)(H(2)btec)](3)(n)(1) and [Ni(2)(1,10'-phen)(2)(H(2)O)(2)(btec)](n)(2) (btec = 1,2,4,5-benzenetetracarboxylate) have been hydrothermally synthesized and characterized by elemental analyses, IR and XPS spectra, TG analysis, X-ray powder diffraction, and single crystal X-ray diffraction. Crystal data for 1: C(90)H(66)N(12)O(30)Ni(6), monoclinic P2(1)/c, a = 10.905(2) A, b = 18.006(4) A, c = 20.551(4) A, beta = 94.91(3) degrees, Z = 2. Crystal data for 2: C(34)H(22)N(4)O(10)Ni(2), monoclinic P2(1)/n, a = 10.122(2) A, b = 9.3106(19) A, c = 15.690(3) A, beta = 92.03(3) degrees, Z = 2. Compound 1 exhibits a novel one-dimensional chainlike structure, in which the dinuclear Ni centers are linked by the btec ligands. Furthermore, the adjacent chains are linked into a 2-D wavelike layer via the strong OH.O hydrogen bonding interactions. Compound 2 possesses an unusual two-dimensional steplike network with interesting rhombic grids. Both compounds exhibit unprecedented metal-organic ligand construction modes in [M/btec/L] (M = transition metal; L = chelate ligands) systems. The magnetic behaviors of compounds 1 and 2 have been studied.

Journal Article↗
PubMed2003

New high-dimensional networks based on polyoxometalate and crown ether building blocks.

Three novel supramolecular assemblies constructed from polyoxometalate and crown ether building blocks, [(DB18C6)Na(H(2)O)(1.5)](2)Mo(6)O(19).CH(3)CN, 1, and [(Na(DB18C6)(H(2)O)(2))(3)(H(2)O)(2)]XMo(12)O(40).6DMF.CH(3)CN (X = P, 2, and As, 3; DB18C6 = dibenzo-18-crown-6; DMF = N,N-dimethylfomamide), have been synthesized and characterized by elemental analyses, IR, UV-vis, EPR, TG, and single crystal X-ray diffraction. Compound 1 crystallizes in the tetragonal space group P4/mbm with a = 16.9701(6) A, c = 14.2676(4) A, and Z = 2. Compound 2 crystallizes in the hexagonal space group P6(3)/m with a = 15.7435(17) A, c = 30.042(7) A, gamma = 120 degrees, and Z = 2. Compound 3 crystallizes in the hexagonal space group P6(3)/m with a = 15.6882(5) A, c = 29.9778(18) A, gamma = 120 degrees, and Z = 2. Compound 1 exhibits an unusual three-dimensional network with one-dimensional sandglasslike channels based on the extensive weak forces between the oxygen atoms on the [Mo(6)O(19)](2)(-) polyoxoanions and the CH(2) groups of crown ether molecules. Compounds 2 and 3 are isostructural, and both contain a novel semiopen cagelike trimeric cation [(Na(DB18C6)(H(2)O)(2))(3)(H(2)O)(2)](3+). In their packing arrangement, an interesting 2-D "honeycomblike" "host" network is formed, in which the [XMo(12)O(40)](3)(-) (X = As and P) polyoxoanion "guests" resided.

Journal Article↗
PubMed2002

Novel hydrogen-bonded three-dimensional networks encapsulating one-dimensional covalent chains: [M(4,4'-bipy)(H2O)(4)](4-abs)(2).nH2O (4,4'-bipy = 4,4'-bipyridine; 4-abs = 4-aminobenzenesulfonate) (M = Co, n = 1; M = Mn, n = 2).

Two novel compounds, [Co(4,4'-bipy)(H(2)O)(4)](4-abs)(2).H(2)O (1) and [Mn(4,4'-bipy)(H(2)O)(4)](4-abs)(2).2H(2)O (2) (4,4'-bipy = 4,4'-bipyridine; 4-abs = 4-aminobenzenesulfonate), have been synthesized in aqueous solution and characterized by single-crystal X-ray diffraction, elemental analyses, UV-vis and IR spectra, and TG analysis. X-ray structural analysis revealed that 1 and 2 both possess unusual hydrogen-bonded three-dimensional (3-D) networks encapsulating one-dimensional (1-D) covalently bonded infinite [M(4,4'-bipy)(H(2)O)(4)](2+) (M = Co, Mn) chains. The 4-abs anions in 1 form 1-D zigzag chains through hydrogen bonds. These chains are further extended through crystallization water molecules into 3-D hydrogen-bonded networks with 1-D channels, in which the [Co(4,4'-bipy)(H(2)O)(4)](2+) linear covalently bonded chains are located. Crystal data for 1: C(22)H(30)CoN(4)O(11)S(2), monoclinic P2(1), a = 11.380(2) A, b = 8.0274(16) A, c = 15.670(3) A, alpha = gamma = 90 degrees, beta = 92.82(3) degrees, Z = 2. Compound 2 contains interesting two-dimensional (2-D) honeycomb-like networks formed by 4-abs anions and lattice water molecules via hydrogen bonding, which are extended through other crystallization water molecules into three dimensions with 1-D hexagonal channels. The [Mn(4,4'-bipy)(H(2)O)(4)](2+) linear covalent chains exist in these channels. Crystal data for 2: C(22)H(32)MnN(4)O(12)S(2), monoclinic P2(1)/c, a = 15.0833(14) A, b = 8.2887(4) A, c = 23.2228(15) A, alpha = gamma = 90 degrees, beta = 95.186(3) degrees, Z = 4.

Journal Article↗